C34H35N7O2 — CID 11455909
9-(2,6-dimethylphenyl)-4-[4-(3-piperidin-1-ylpropoxy)anilino]-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one (PubChem CID 11455909) has the molecular formula C34H35N7O2 and a molecular weight of 573.70 g/mol. Its IUPAC name is 9-(2,6-dimethylphenyl)-4-[4-(3-piperidin-1-ylpropoxy)anilino]-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one.
| Compound Name | 9-(2,6-dimethylphenyl)-4-[4-(3-piperidin-1-ylpropoxy)anilino]-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one |
|---|---|
| PubChem CID | 11455909 |
| Molecular Formula | C34H35N7O2 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | 9-(2,6-dimethylphenyl)-4-[4-(3-piperidin-1-ylpropoxy)anilino]-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one |
| SMILES | Cc1cccc(C)c1-n1c(=O)c2cnc(Nc3ccc(OCCCN4CCCCC4)cc3)nc2n2c3ccccc3nc12 |
| InChI | InChI=1S/C34H35N7O2/c1-23-10-8-11-24(2)30(23)41-32(42)27-22-35-33(38-31(27)40-29-13-5-4-12-28(29)37-34(40)41)36-25-14-16-26(17-15-25)43-21-9-20-39-18-6-3-7-19-39/h4-5,8,10-17,22H,3,6-7,9,18-21H2,1-2H3,(H,35,36,38) |
| InChIKey | HHFKFLKVLVSVDO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|