C40H40N2O2 — CID 11455987
[(2R,3S)-2-(benzylamino)-3-(dibenzylamino)-4-phenylbutyl] (E)-3-phenylprop-2-enoate (PubChem CID 11455987) has the molecular formula C40H40N2O2 and a molecular weight of 580.77 g/mol. Its IUPAC name is [(2R,3S)-2-(benzylamino)-3-(dibenzylamino)-4-phenylbutyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R,3S)-2-(benzylamino)-3-(dibenzylamino)-4-phenylbutyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 11455987 |
| Molecular Formula | C40H40N2O2 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | [(2R,3S)-2-(benzylamino)-3-(dibenzylamino)-4-phenylbutyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OC[C@H](NCc1ccccc1)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C40H40N2O2/c43-40(27-26-33-16-6-1-7-17-33)44-32-38(41-29-35-20-10-3-11-21-35)39(28-34-18-8-2-9-19-34)42(30-36-22-12-4-13-23-36)31-37-24-14-5-15-25-37/h1-27,38-39,41H,28-32H2/b27-26+/t38-,39-/m0/s1 |
| InChIKey | VEOIRRHOMFUKJW-UYUFRVLVSA-N |
| XLogP | 7.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|