C14H16Br2FNO — CID 114561150
(2-bromo-6-fluorophenyl)-[2-(bromomethyl)azepan-1-yl]methanone (PubChem CID 114561150) has the molecular formula C14H16Br2FNO and a molecular weight of 393.09 g/mol. Its IUPAC name is (2-bromo-6-fluorophenyl)-[2-(bromomethyl)azepan-1-yl]methanone.
| Compound Name | (2-bromo-6-fluorophenyl)-[2-(bromomethyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 114561150 |
| Molecular Formula | C14H16Br2FNO |
| Molecular Weight | 393.09 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | (2-bromo-6-fluorophenyl)-[2-(bromomethyl)azepan-1-yl]methanone |
| SMILES | O=C(c1c(F)cccc1Br)N1CCCCCC1CBr |
| InChI | InChI=1S/C14H16Br2FNO/c15-9-10-5-2-1-3-8-18(10)14(19)13-11(16)6-4-7-12(13)17/h4,6-7,10H,1-3,5,8-9H2 |
| InChIKey | WUWSAUDYBVIZTR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.09 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|