C13H14BrF2NO — CID 80661009
[2-(bromomethyl)piperidin-1-yl]-(2,3-difluorophenyl)methanone (PubChem CID 80661009) has the molecular formula C13H14BrF2NO and a molecular weight of 318.16 g/mol. Its IUPAC name is [2-(bromomethyl)piperidin-1-yl]-(2,3-difluorophenyl)methanone.
| Compound Name | [2-(bromomethyl)piperidin-1-yl]-(2,3-difluorophenyl)methanone |
|---|---|
| PubChem CID | 80661009 |
| Molecular Formula | C13H14BrF2NO |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | [2-(bromomethyl)piperidin-1-yl]-(2,3-difluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1F)N1CCCCC1CBr |
| InChI | InChI=1S/C13H14BrF2NO/c14-8-9-4-1-2-7-17(9)13(18)10-5-3-6-11(15)12(10)16/h3,5-6,9H,1-2,4,7-8H2 |
| InChIKey | ZCDYMIASYXYXIN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|