C15H17BrFNO3 — CID 81499432
methyl 2-[1-(2-bromo-3-fluorobenzoyl)piperidin-2-yl]acetate (PubChem CID 81499432) has the molecular formula C15H17BrFNO3 and a molecular weight of 358.21 g/mol. Its IUPAC name is methyl 2-[1-(2-bromo-3-fluorobenzoyl)piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-(2-bromo-3-fluorobenzoyl)piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 81499432 |
| Molecular Formula | C15H17BrFNO3 |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | methyl 2-[1-(2-bromo-3-fluorobenzoyl)piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1C(=O)c1cccc(F)c1Br |
| InChI | InChI=1S/C15H17BrFNO3/c1-21-13(19)9-10-5-2-3-8-18(10)15(20)11-6-4-7-12(17)14(11)16/h4,6-7,10H,2-3,5,8-9H2,1H3 |
| InChIKey | SWONYYXSUPSBIM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |