C15H19ClN2O3 — CID 61140064
methyl 2-[1-(2-amino-4-chlorobenzoyl)piperidin-2-yl]acetate (PubChem CID 61140064) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is methyl 2-[1-(2-amino-4-chlorobenzoyl)piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-(2-amino-4-chlorobenzoyl)piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 61140064 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | methyl 2-[1-(2-amino-4-chlorobenzoyl)piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1C(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C15H19ClN2O3/c1-21-14(19)9-11-4-2-3-7-18(11)15(20)12-6-5-10(16)8-13(12)17/h5-6,8,11H,2-4,7,9,17H2,1H3 |
| InChIKey | RCIIRACHTFENGB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|