C15H17Br2NO3 — CID 103908243
methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate (PubChem CID 103908243) has the molecular formula C15H17Br2NO3 and a molecular weight of 419.11 g/mol. Its IUPAC name is methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 103908243 |
| Molecular Formula | C15H17Br2NO3 |
| Molecular Weight | 419.11 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C15H17Br2NO3/c1-21-14(19)9-13-4-2-3-5-18(13)15(20)10-6-11(16)8-12(17)7-10/h6-8,13H,2-5,9H2,1H3 |
| InChIKey | LBDDXQBNWVWTDQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.11 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |