methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate

C15H17Br2NO3 — CID 103908243

IUPACmethyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate
SMILESCOC(=O)CC1CCCCN1C(=O)c1cc(Br)cc(Br)c1
InChIInChI=1S/C15H17Br2NO3/c1-21-14(19)9-13-4-2-3-5-18(13)15(20)10-6-11(16)8-12(17)7-10/h6-8,13H,2-5,9H2,1H3
InChIKeyLBDDXQBNWVWTDQ-UHFFFAOYSA-N
MW419.11 g/mol
LogP3.77
Rot. Bonds3

About methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate

methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate (PubChem CID 103908243) has the molecular formula C15H17Br2NO3 and a molecular weight of 419.11 g/mol. Its IUPAC name is methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate
PubChem CID103908243
Molecular FormulaC15H17Br2NO3
Molecular Weight419.11 g/mol
Exact Mass416.96
IUPAC Namemethyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate
SMILESCOC(=O)CC1CCCCN1C(=O)c1cc(Br)cc(Br)c1
InChIInChI=1S/C15H17Br2NO3/c1-21-14(19)9-13-4-2-3-5-18(13)15(20)10-6-11(16)8-12(17)7-10/h6-8,13H,2-5,9H2,1H3
InChIKeyLBDDXQBNWVWTDQ-UHFFFAOYSA-N
XLogP3.77
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500419.11
LogP ≤ 53.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate?
The IUPAC name of methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate (CID 103908243) is methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate.
What is the SMILES notation for methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate?
The canonical SMILES for methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate is COC(=O)CC1CCCCN1C(=O)c1cc(Br)cc(Br)c1.
What is the InChIKey of methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate?
The InChIKey is LBDDXQBNWVWTDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Br2NO3/c1-21-14(19)9-13-4-2-3-5-18(13)15(20)10-6-11(16)8-12(17)7-10/h6-8,13H,2-5,9H2,1H3.
What are the key properties of methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate?
methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate has a molecular weight of 419.11 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(3,5-dibromobenzoyl)piperidin-2-yl]acetate is sourced from PubChem (CID 103908243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).