C16H18F3NO4 — CID 166280266
methyl 2-[(2R)-1-[3-hydroxy-5-(trifluoromethyl)benzoyl]piperidin-2-yl]acetate (PubChem CID 166280266) has the molecular formula C16H18F3NO4 and a molecular weight of 345.32 g/mol. Its IUPAC name is methyl 2-[(2R)-1-[3-hydroxy-5-(trifluoromethyl)benzoyl]piperidin-2-yl]acetate.
| Compound Name | methyl 2-[(2R)-1-[3-hydroxy-5-(trifluoromethyl)benzoyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 166280266 |
| Molecular Formula | C16H18F3NO4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | methyl 2-[(2R)-1-[3-hydroxy-5-(trifluoromethyl)benzoyl]piperidin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1CCCCN1C(=O)c1cc(O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F3NO4/c1-24-14(22)9-12-4-2-3-5-20(12)15(23)10-6-11(16(17,18)19)8-13(21)7-10/h6-8,12,21H,2-5,9H2,1H3/t12-/m1/s1 |
| InChIKey | VAHYAULNMRQPLR-GFCCVEGCSA-N |
| XLogP | 2.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |