C13H15BrFN3OS — CID 114561280
2-[5-(2-bromo-6-fluorophenyl)-1,3,4-thiadiazol-2-yl]-N-(2-methoxyethyl)ethanamine (PubChem CID 114561280) has the molecular formula C13H15BrFN3OS and a molecular weight of 360.25 g/mol. Its IUPAC name is 2-[5-(2-bromo-6-fluorophenyl)-1,3,4-thiadiazol-2-yl]-N-(2-methoxyethyl)ethanamine.
| Compound Name | 2-[5-(2-bromo-6-fluorophenyl)-1,3,4-thiadiazol-2-yl]-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 114561280 |
| Molecular Formula | C13H15BrFN3OS |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 2-[5-(2-bromo-6-fluorophenyl)-1,3,4-thiadiazol-2-yl]-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCNCCc1nnc(-c2c(F)cccc2Br)s1 |
| InChI | InChI=1S/C13H15BrFN3OS/c1-19-8-7-16-6-5-11-17-18-13(20-11)12-9(14)3-2-4-10(12)15/h2-4,16H,5-8H2,1H3 |
| InChIKey | HNLBQJZPRIDPFI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|