C12H11N5OS — CID 114561888
4-N-(6-methoxy-1,3-benzothiazol-2-yl)pyrimidine-4,6-diamine (PubChem CID 114561888) has the molecular formula C12H11N5OS and a molecular weight of 273.32 g/mol. Its IUPAC name is 4-N-(6-methoxy-1,3-benzothiazol-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(6-methoxy-1,3-benzothiazol-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 114561888 |
| Molecular Formula | C12H11N5OS |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-N-(6-methoxy-1,3-benzothiazol-2-yl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc2nc(Nc3cc(N)ncn3)sc2c1 |
| InChI | InChI=1S/C12H11N5OS/c1-18-7-2-3-8-9(4-7)19-12(16-8)17-11-5-10(13)14-6-15-11/h2-6H,1H3,(H3,13,14,15,16,17) |
| InChIKey | IWDXPVIKHDXMRK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |