C15H16N6OS — CID 19136044
4-N-(6-methoxy-1,3-benzothiazol-2-yl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine (PubChem CID 19136044) has the molecular formula C15H16N6OS and a molecular weight of 328.40 g/mol. Its IUPAC name is 4-N-(6-methoxy-1,3-benzothiazol-2-yl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(6-methoxy-1,3-benzothiazol-2-yl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19136044 |
| Molecular Formula | C15H16N6OS |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-N-(6-methoxy-1,3-benzothiazol-2-yl)-6-N-prop-2-enylpyrimidine-4,5,6-triamine |
| SMILES | C=CCNc1ncnc(Nc2nc3ccc(OC)cc3s2)c1N |
| InChI | InChI=1S/C15H16N6OS/c1-3-6-17-13-12(16)14(19-8-18-13)21-15-20-10-5-4-9(22-2)7-11(10)23-15/h3-5,7-8H,1,6,16H2,2H3,(H2,17,18,19,20,21) |
| InChIKey | CKCYWAQYKFTCFD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|