C13H10Cl2F3N3 — CID 114562389
2-chloro-N-[1-(2-chlorophenyl)ethyl]-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114562389) has the molecular formula C13H10Cl2F3N3 and a molecular weight of 336.14 g/mol. Its IUPAC name is 2-chloro-N-[1-(2-chlorophenyl)ethyl]-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[1-(2-chlorophenyl)ethyl]-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114562389 |
| Molecular Formula | C13H10Cl2F3N3 |
| Molecular Weight | 336.14 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2-chloro-N-[1-(2-chlorophenyl)ethyl]-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CC(Nc1cc(C(F)(F)F)nc(Cl)n1)c1ccccc1Cl |
| InChI | InChI=1S/C13H10Cl2F3N3/c1-7(8-4-2-3-5-9(8)14)19-11-6-10(13(16,17)18)20-12(15)21-11/h2-7H,1H3,(H,19,20,21) |
| InChIKey | UVUGTBUXAUYSJG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.14 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |