C10H13ClF3N3S — CID 114562897
2-chloro-N-(4-methylsulfanylbutan-2-yl)-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114562897) has the molecular formula C10H13ClF3N3S and a molecular weight of 299.75 g/mol. Its IUPAC name is 2-chloro-N-(4-methylsulfanylbutan-2-yl)-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(4-methylsulfanylbutan-2-yl)-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114562897 |
| Molecular Formula | C10H13ClF3N3S |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-chloro-N-(4-methylsulfanylbutan-2-yl)-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CSCCC(C)Nc1cc(C(F)(F)F)nc(Cl)n1 |
| InChI | InChI=1S/C10H13ClF3N3S/c1-6(3-4-18-2)15-8-5-7(10(12,13)14)16-9(11)17-8/h5-6H,3-4H2,1-2H3,(H,15,16,17) |
| InChIKey | NNUVHUKLOAHSRS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |