C13H17ClF3N3O — CID 114562559
[1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-4-methylcyclohexyl]methanol (PubChem CID 114562559) has the molecular formula C13H17ClF3N3O and a molecular weight of 323.75 g/mol. Its IUPAC name is [1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-4-methylcyclohexyl]methanol.
| Compound Name | [1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-4-methylcyclohexyl]methanol |
|---|---|
| PubChem CID | 114562559 |
| Molecular Formula | C13H17ClF3N3O |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | [1-[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]amino]-4-methylcyclohexyl]methanol |
| SMILES | CC1CCC(CO)(Nc2cc(C(F)(F)F)nc(Cl)n2)CC1 |
| InChI | InChI=1S/C13H17ClF3N3O/c1-8-2-4-12(7-21,5-3-8)20-10-6-9(13(15,16)17)18-11(14)19-10/h6,8,21H,2-5,7H2,1H3,(H,18,19,20) |
| InChIKey | GZWJCCSFKZKUSC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |