C15H27N5O — CID 80803602
[1-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]-4-methylcyclohexyl]methanol (PubChem CID 80803602) has the molecular formula C15H27N5O and a molecular weight of 293.42 g/mol. Its IUPAC name is [1-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]-4-methylcyclohexyl]methanol.
| Compound Name | [1-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]-4-methylcyclohexyl]methanol |
|---|---|
| PubChem CID | 80803602 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | [1-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]-4-methylcyclohexyl]methanol |
| SMILES | CCCNc1cc(NC2(CO)CCC(C)CC2)nc(N)n1 |
| InChI | InChI=1S/C15H27N5O/c1-3-8-17-12-9-13(19-14(16)18-12)20-15(10-21)6-4-11(2)5-7-15/h9,11,21H,3-8,10H2,1-2H3,(H4,16,17,18,19,20) |
| InChIKey | PZXRNTKGFDDTBG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |