C12H8BrClF3N3 — CID 114562802
N-(2-bromo-3-methylphenyl)-2-chloro-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114562802) has the molecular formula C12H8BrClF3N3 and a molecular weight of 366.57 g/mol. Its IUPAC name is N-(2-bromo-3-methylphenyl)-2-chloro-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-(2-bromo-3-methylphenyl)-2-chloro-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114562802 |
| Molecular Formula | C12H8BrClF3N3 |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | N-(2-bromo-3-methylphenyl)-2-chloro-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1cccc(Nc2cc(C(F)(F)F)nc(Cl)n2)c1Br |
| InChI | InChI=1S/C12H8BrClF3N3/c1-6-3-2-4-7(10(6)13)18-9-5-8(12(15,16)17)19-11(14)20-9/h2-5H,1H3,(H,18,19,20) |
| InChIKey | QPVCRJWIONOBKB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |