C12H8ClF4N3 — CID 115649814
2-chloro-N-(4-fluoro-2-methylphenyl)-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 115649814) has the molecular formula C12H8ClF4N3 and a molecular weight of 305.66 g/mol. Its IUPAC name is 2-chloro-N-(4-fluoro-2-methylphenyl)-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(4-fluoro-2-methylphenyl)-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115649814 |
| Molecular Formula | C12H8ClF4N3 |
| Molecular Weight | 305.66 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-chloro-N-(4-fluoro-2-methylphenyl)-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1cc(F)ccc1Nc1cc(C(F)(F)F)nc(Cl)n1 |
| InChI | InChI=1S/C12H8ClF4N3/c1-6-4-7(14)2-3-8(6)18-10-5-9(12(15,16)17)19-11(13)20-10/h2-5H,1H3,(H,18,19,20) |
| InChIKey | YVSRLJHEHSQYLB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.66 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |