C11H5Cl2F4N3 — CID 107368848
2-chloro-N-(3-chloro-5-fluorophenyl)-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 107368848) has the molecular formula C11H5Cl2F4N3 and a molecular weight of 326.08 g/mol. Its IUPAC name is 2-chloro-N-(3-chloro-5-fluorophenyl)-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(3-chloro-5-fluorophenyl)-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107368848 |
| Molecular Formula | C11H5Cl2F4N3 |
| Molecular Weight | 326.08 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 2-chloro-N-(3-chloro-5-fluorophenyl)-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Fc1cc(Cl)cc(Nc2cc(C(F)(F)F)nc(Cl)n2)c1 |
| InChI | InChI=1S/C11H5Cl2F4N3/c12-5-1-6(14)3-7(2-5)18-9-4-8(11(15,16)17)19-10(13)20-9/h1-4H,(H,18,19,20) |
| InChIKey | YPPZLTGKMAMJKL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.08 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |