C10H5Cl4N3 — CID 10380610
2,6-dichloro-N-(3,5-dichlorophenyl)pyrimidin-4-amine (PubChem CID 10380610) has the molecular formula C10H5Cl4N3 and a molecular weight of 308.98 g/mol. Its IUPAC name is 2,6-dichloro-N-(3,5-dichlorophenyl)pyrimidin-4-amine.
| Compound Name | 2,6-dichloro-N-(3,5-dichlorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 10380610 |
| Molecular Formula | C10H5Cl4N3 |
| Molecular Weight | 308.98 g/mol |
| Exact Mass | 306.92 |
| IUPAC Name | 2,6-dichloro-N-(3,5-dichlorophenyl)pyrimidin-4-amine |
| SMILES | Clc1cc(Cl)cc(Nc2cc(Cl)nc(Cl)n2)c1 |
| InChI | InChI=1S/C10H5Cl4N3/c11-5-1-6(12)3-7(2-5)15-9-4-8(13)16-10(14)17-9/h1-4H,(H,15,16,17) |
| InChIKey | NBVXLUUUIMZHKH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.98 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |