C22H13Cl5F6N6O2 — CID 159576870
2,6-dichloro-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine;2,4,6-trichloropyrimidine;4-(trifluoromethoxy)aniline (PubChem CID 159576870) has the molecular formula C22H13Cl5F6N6O2 and a molecular weight of 684.64 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine;2,4,6-trichloropyrimidine;4-(trifluoromethoxy)aniline.
| Compound Name | 2,6-dichloro-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine;2,4,6-trichloropyrimidine;4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 159576870 |
| Molecular Formula | C22H13Cl5F6N6O2 |
| Molecular Weight | 684.64 g/mol |
| Exact Mass | 681.94 |
| IUPAC Name | 2,6-dichloro-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine;2,4,6-trichloropyrimidine;4-(trifluoromethoxy)aniline |
| SMILES | Clc1cc(Cl)nc(Cl)n1.FC(F)(F)Oc1ccc(Nc2cc(Cl)nc(Cl)n2)cc1.Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H6Cl2F3N3O.C7H6F3NO.C4HCl3N2/c12-8-5-9(19-10(13)18-8)17-6-1-3-7(4-2-6)20-11(14,15)16;8-7(9,10)12-6-3-1-5(11)2-4-6;5-2-1-3(6)9-4(7)8-2/h1-5H,(H,17,18,19);1-4H,11H2;1H |
| InChIKey | MINCEEILTGPQMF-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.64 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|