C8H10F3N3OS — CID 114566875
3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropan-1-ol (PubChem CID 114566875) has the molecular formula C8H10F3N3OS and a molecular weight of 253.25 g/mol. Its IUPAC name is 3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropan-1-ol.
| Compound Name | 3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 114566875 |
| Molecular Formula | C8H10F3N3OS |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropan-1-ol |
| SMILES | Nc1nc(SCCCO)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H10F3N3OS/c9-8(10,11)5-4-6(14-7(12)13-5)16-3-1-2-15/h4,15H,1-3H2,(H2,12,13,14) |
| InChIKey | RTOROLVNUZDQMI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|