C9H10F3N3O2S — CID 114566747
methyl 3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropanoate (PubChem CID 114566747) has the molecular formula C9H10F3N3O2S and a molecular weight of 281.26 g/mol. Its IUPAC name is methyl 3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 114566747 |
| Molecular Formula | C9H10F3N3O2S |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | methyl 3-[2-amino-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropanoate |
| SMILES | COC(=O)CCSc1cc(C(F)(F)F)nc(N)n1 |
| InChI | InChI=1S/C9H10F3N3O2S/c1-17-7(16)2-3-18-6-4-5(9(10,11)12)14-8(13)15-6/h4H,2-3H2,1H3,(H2,13,14,15) |
| InChIKey | DUBZYPMVGHWHEB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |