C8H11NO2S2 — CID 53256614
methyl 3-(3-aminothiophen-2-yl)sulfanylpropanoate (PubChem CID 53256614) has the molecular formula C8H11NO2S2 and a molecular weight of 217.31 g/mol. Its IUPAC name is methyl 3-(3-aminothiophen-2-yl)sulfanylpropanoate.
| Compound Name | methyl 3-(3-aminothiophen-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 53256614 |
| Molecular Formula | C8H11NO2S2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | methyl 3-(3-aminothiophen-2-yl)sulfanylpropanoate |
| SMILES | COC(=O)CCSc1sccc1N |
| InChI | InChI=1S/C8H11NO2S2/c1-11-7(10)3-5-13-8-6(9)2-4-12-8/h2,4H,3,5,9H2,1H3 |
| InChIKey | YBBDDARIUGACPP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |