C11H12F3N5S — CID 114566951
2-hydrazinyl-N-methyl-N-(thiophen-2-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114566951) has the molecular formula C11H12F3N5S and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-hydrazinyl-N-methyl-N-(thiophen-2-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-methyl-N-(thiophen-2-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114566951 |
| Molecular Formula | C11H12F3N5S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-hydrazinyl-N-methyl-N-(thiophen-2-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CN(Cc1cccs1)c1cc(C(F)(F)F)nc(NN)n1 |
| InChI | InChI=1S/C11H12F3N5S/c1-19(6-7-3-2-4-20-7)9-5-8(11(12,13)14)16-10(17-9)18-15/h2-5H,6,15H2,1H3,(H,16,17,18) |
| InChIKey | VJWHWGCGXJBSMR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|