C13H13F3N2S — CID 43527368
1-N-methyl-1-N-(thiophen-2-ylmethyl)-4-(trifluoromethyl)benzene-1,2-diamine (PubChem CID 43527368) has the molecular formula C13H13F3N2S and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-N-methyl-1-N-(thiophen-2-ylmethyl)-4-(trifluoromethyl)benzene-1,2-diamine.
| Compound Name | 1-N-methyl-1-N-(thiophen-2-ylmethyl)-4-(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 43527368 |
| Molecular Formula | C13H13F3N2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-N-methyl-1-N-(thiophen-2-ylmethyl)-4-(trifluoromethyl)benzene-1,2-diamine |
| SMILES | CN(Cc1cccs1)c1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C13H13F3N2S/c1-18(8-10-3-2-6-19-10)12-5-4-9(7-11(12)17)13(14,15)16/h2-7H,8,17H2,1H3 |
| InChIKey | BEZGVBPIMOFGGM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|