C12H13IN2S — CID 66092918
2-iodo-1-N-methyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-diamine (PubChem CID 66092918) has the molecular formula C12H13IN2S and a molecular weight of 344.22 g/mol. Its IUPAC name is 2-iodo-1-N-methyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2-iodo-1-N-methyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 66092918 |
| Molecular Formula | C12H13IN2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 2-iodo-1-N-methyl-1-N-(thiophen-2-ylmethyl)benzene-1,4-diamine |
| SMILES | CN(Cc1cccs1)c1ccc(N)cc1I |
| InChI | InChI=1S/C12H13IN2S/c1-15(8-10-3-2-6-16-10)12-5-4-9(14)7-11(12)13/h2-7H,8,14H2,1H3 |
| InChIKey | JMVSHJNAQAQGQJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|