C15H15F3N2S — CID 61451030
1-N-cyclopropyl-1-N-(thiophen-2-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 61451030) has the molecular formula C15H15F3N2S and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-N-cyclopropyl-1-N-(thiophen-2-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-cyclopropyl-1-N-(thiophen-2-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 61451030 |
| Molecular Formula | C15H15F3N2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-N-cyclopropyl-1-N-(thiophen-2-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(N(Cc2cccs2)C2CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3N2S/c16-15(17,18)13-8-10(19)3-6-14(13)20(11-4-5-11)9-12-2-1-7-21-12/h1-3,6-8,11H,4-5,9,19H2 |
| InChIKey | YFQQCTCOIPUQMG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|