C15H13BrN2S — CID 114890523
5-bromo-2-[cyclopropyl(thiophen-2-ylmethyl)amino]benzonitrile (PubChem CID 114890523) has the molecular formula C15H13BrN2S and a molecular weight of 333.25 g/mol. Its IUPAC name is 5-bromo-2-[cyclopropyl(thiophen-2-ylmethyl)amino]benzonitrile.
| Compound Name | 5-bromo-2-[cyclopropyl(thiophen-2-ylmethyl)amino]benzonitrile |
|---|---|
| PubChem CID | 114890523 |
| Molecular Formula | C15H13BrN2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 5-bromo-2-[cyclopropyl(thiophen-2-ylmethyl)amino]benzonitrile |
| SMILES | N#Cc1cc(Br)ccc1N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C15H13BrN2S/c16-12-3-6-15(11(8-12)9-17)18(13-4-5-13)10-14-2-1-7-19-14/h1-3,6-8,13H,4-5,10H2 |
| InChIKey | AVBYZEBBZSXXCX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |