C16H18BrNOS — CID 78940254
(1S)-1-[3-bromo-4-[cyclopropyl(thiophen-2-ylmethyl)amino]phenyl]ethanol (PubChem CID 78940254) has the molecular formula C16H18BrNOS and a molecular weight of 352.30 g/mol. Its IUPAC name is (1S)-1-[3-bromo-4-[cyclopropyl(thiophen-2-ylmethyl)amino]phenyl]ethanol.
| Compound Name | (1S)-1-[3-bromo-4-[cyclopropyl(thiophen-2-ylmethyl)amino]phenyl]ethanol |
|---|---|
| PubChem CID | 78940254 |
| Molecular Formula | C16H18BrNOS |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | (1S)-1-[3-bromo-4-[cyclopropyl(thiophen-2-ylmethyl)amino]phenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(N(Cc2cccs2)C2CC2)c(Br)c1 |
| InChI | InChI=1S/C16H18BrNOS/c1-11(19)12-4-7-16(15(17)9-12)18(13-5-6-13)10-14-3-2-8-20-14/h2-4,7-9,11,13,19H,5-6,10H2,1H3/t11-/m0/s1 |
| InChIKey | RTYGVNOCIYBLTH-NSHDSACASA-N |
| XLogP | 4.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|