C16H19FN2S — CID 63368648
4-[(1R)-1-aminoethyl]-N-cyclopropyl-2-fluoro-N-(thiophen-2-ylmethyl)aniline (PubChem CID 63368648) has the molecular formula C16H19FN2S and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-[(1R)-1-aminoethyl]-N-cyclopropyl-2-fluoro-N-(thiophen-2-ylmethyl)aniline.
| Compound Name | 4-[(1R)-1-aminoethyl]-N-cyclopropyl-2-fluoro-N-(thiophen-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 63368648 |
| Molecular Formula | C16H19FN2S |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-[(1R)-1-aminoethyl]-N-cyclopropyl-2-fluoro-N-(thiophen-2-ylmethyl)aniline |
| SMILES | C[C@@H](N)c1ccc(N(Cc2cccs2)C2CC2)c(F)c1 |
| InChI | InChI=1S/C16H19FN2S/c1-11(18)12-4-7-16(15(17)9-12)19(13-5-6-13)10-14-3-2-8-20-14/h2-4,7-9,11,13H,5-6,10,18H2,1H3/t11-/m1/s1 |
| InChIKey | ZSPGQDGGBKQCNN-LLVKDONJSA-N |
| XLogP | 4.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |