C15H17N3OS — CID 63356225
4-amino-3-[cyclopropyl(thiophen-2-ylmethyl)amino]benzamide (PubChem CID 63356225) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 4-amino-3-[cyclopropyl(thiophen-2-ylmethyl)amino]benzamide.
| Compound Name | 4-amino-3-[cyclopropyl(thiophen-2-ylmethyl)amino]benzamide |
|---|---|
| PubChem CID | 63356225 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-amino-3-[cyclopropyl(thiophen-2-ylmethyl)amino]benzamide |
| SMILES | NC(=O)c1ccc(N)c(N(Cc2cccs2)C2CC2)c1 |
| InChI | InChI=1S/C15H17N3OS/c16-13-6-3-10(15(17)19)8-14(13)18(11-4-5-11)9-12-2-1-7-20-12/h1-3,6-8,11H,4-5,9,16H2,(H2,17,19) |
| InChIKey | XNHNLVCHMMXSHF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|