C14H14N4OS — CID 61450921
4-N-cyclopropyl-4-N-(thiophen-2-ylmethyl)-2,1,3-benzoxadiazole-4,7-diamine (PubChem CID 61450921) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-N-cyclopropyl-4-N-(thiophen-2-ylmethyl)-2,1,3-benzoxadiazole-4,7-diamine.
| Compound Name | 4-N-cyclopropyl-4-N-(thiophen-2-ylmethyl)-2,1,3-benzoxadiazole-4,7-diamine |
|---|---|
| PubChem CID | 61450921 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 4-N-cyclopropyl-4-N-(thiophen-2-ylmethyl)-2,1,3-benzoxadiazole-4,7-diamine |
| SMILES | Nc1ccc(N(Cc2cccs2)C2CC2)c2nonc12 |
| InChI | InChI=1S/C14H14N4OS/c15-11-5-6-12(14-13(11)16-19-17-14)18(9-3-4-9)8-10-2-1-7-20-10/h1-2,5-7,9H,3-4,8,15H2 |
| InChIKey | LDXCFNHZMOIILI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|