C12H19N3O3 — CID 114570600
5,5-dimethyl-3-[(2-oxo-1H-pyrazin-3-yl)amino]hexanoic acid (PubChem CID 114570600) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 5,5-dimethyl-3-[(2-oxo-1H-pyrazin-3-yl)amino]hexanoic acid.
| Compound Name | 5,5-dimethyl-3-[(2-oxo-1H-pyrazin-3-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 114570600 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 5,5-dimethyl-3-[(2-oxo-1H-pyrazin-3-yl)amino]hexanoic acid |
| SMILES | CC(C)(C)CC(CC(=O)O)Nc1ncc[nH]c1=O |
| InChI | InChI=1S/C12H19N3O3/c1-12(2,3)7-8(6-9(16)17)15-10-11(18)14-5-4-13-10/h4-5,8H,6-7H2,1-3H3,(H,13,15)(H,14,18)(H,16,17) |
| InChIKey | WHJKNBGHDSBXKK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |