C12H20N6O2 — CID 114570765
N'-hydroxy-2-methyl-2-[4-(2-oxo-1H-pyrazin-3-yl)piperazin-1-yl]propanimidamide (PubChem CID 114570765) has the molecular formula C12H20N6O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-2-[4-(2-oxo-1H-pyrazin-3-yl)piperazin-1-yl]propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-2-[4-(2-oxo-1H-pyrazin-3-yl)piperazin-1-yl]propanimidamide |
|---|---|
| PubChem CID | 114570765 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N'-hydroxy-2-methyl-2-[4-(2-oxo-1H-pyrazin-3-yl)piperazin-1-yl]propanimidamide |
| SMILES | CC(C)(/C(N)=N/O)N1CCN(c2ncc[nH]c2=O)CC1 |
| InChI | InChI=1S/C12H20N6O2/c1-12(2,11(13)16-20)18-7-5-17(6-8-18)9-10(19)15-4-3-14-9/h3-4,20H,5-8H2,1-2H3,(H2,13,16)(H,15,19) |
| InChIKey | DASBILISWIFOIK-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|