C8H11N3O3S — CID 115684957
3-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrazin-2-one (PubChem CID 115684957) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrazin-2-one.
| Compound Name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 115684957 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrazin-2-one |
| SMILES | O=c1[nH]ccnc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H11N3O3S/c12-8-7(9-1-2-10-8)11-3-5-15(13,14)6-4-11/h1-2H,3-6H2,(H,10,12) |
| InChIKey | NWEUVSWLELXYSS-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |