C7H9N3O3S — CID 114573956
2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid (PubChem CID 114573956) has the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. Its IUPAC name is 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid.
| Compound Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 114573956 |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid |
| SMILES | CC(Sc1nc[nH]c(=O)c1N)C(=O)O |
| InChI | InChI=1S/C7H9N3O3S/c1-3(7(12)13)14-6-4(8)5(11)9-2-10-6/h2-3H,8H2,1H3,(H,12,13)(H,9,10,11) |
| InChIKey | JYRDUDZJIYPIAG-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |