C8H13N3O2S — CID 114578922
5-amino-4-(4-hydroxybutan-2-ylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 114578922) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 5-amino-4-(4-hydroxybutan-2-ylsulfanyl)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(4-hydroxybutan-2-ylsulfanyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114578922 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 5-amino-4-(4-hydroxybutan-2-ylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | CC(CCO)Sc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C8H13N3O2S/c1-5(2-3-12)14-8-6(9)7(13)10-4-11-8/h4-5,12H,2-3,9H2,1H3,(H,10,11,13) |
| InChIKey | SJGOLLNOYVPOHR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |