C7H9ClN2O2S — CID 114578936
5-chloro-4-(3-hydroxypropylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 114578936) has the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. Its IUPAC name is 5-chloro-4-(3-hydroxypropylsulfanyl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(3-hydroxypropylsulfanyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114578936 |
| Molecular Formula | C7H9ClN2O2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 5-chloro-4-(3-hydroxypropylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(SCCCO)c1Cl |
| InChI | InChI=1S/C7H9ClN2O2S/c8-5-6(12)9-4-10-7(5)13-3-1-2-11/h4,11H,1-3H2,(H,9,10,12) |
| InChIKey | PDNLCBJHVMUESA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|