C7H9ClN2O3S — CID 114578954
5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 114578954) has the molecular formula C7H9ClN2O3S and a molecular weight of 236.68 g/mol. Its IUPAC name is 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114578954 |
| Molecular Formula | C7H9ClN2O3S |
| Molecular Weight | 236.68 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(SCC(O)CO)c1Cl |
| InChI | InChI=1S/C7H9ClN2O3S/c8-5-6(13)9-3-10-7(5)14-2-4(12)1-11/h3-4,11-12H,1-2H2,(H,9,10,13) |
| InChIKey | ZAAOQEHJOHDPAS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.68 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |