About 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one
5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 114578954) has the molecular formula C7H9ClN2O3S
and a molecular weight of 236.68 g/mol. Its IUPAC name is 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one |
| PubChem CID | 114578954 |
| Molecular Formula | C7H9ClN2O3S |
| Molecular Weight | 236.68 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(SCC(O)CO)c1Cl |
| InChI | InChI=1S/C7H9ClN2O3S/c8-5-6(13)9-3-10-7(5)14-2-4(12)1-11/h3-4,11-12H,1-2H2,(H,9,10,13) |
| InChIKey | ZAAOQEHJOHDPAS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.68 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one?
The IUPAC name of 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one (CID 114578954) is 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one is O=c1[nH]cnc(SCC(O)CO)c1Cl.
What is the InChIKey of 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one?
The InChIKey is ZAAOQEHJOHDPAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O3S/c8-5-6(13)9-3-10-7(5)14-2-4(12)1-11/h3-4,11-12H,1-2H2,(H,9,10,13).
What are the key properties of 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one?
5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one has a molecular weight of 236.68 g/mol, XLogP of -0.13, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-(2,3-dihydroxypropylsulfanyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 114578954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).