About naphthalene-1,5-dicarbonitrile
naphthalene-1,5-dicarbonitrile (PubChem CID 11458009) has the molecular formula C12H6N2
and a molecular weight of 178.19 g/mol. Its IUPAC name is naphthalene-1,5-dicarbonitrile.
Molecular Properties
| Compound Name | naphthalene-1,5-dicarbonitrile |
| PubChem CID | 11458009 |
| Molecular Formula | C12H6N2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | naphthalene-1,5-dicarbonitrile |
| SMILES | N#Cc1cccc2c(C#N)cccc12 |
| InChI | InChI=1S/C12H6N2/c13-7-9-3-1-5-11-10(8-14)4-2-6-12(9)11/h1-6H |
| InChIKey | WNDSQRGJJHSKCQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze naphthalene-1,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1,5-dicarbonitrile?
The IUPAC name of naphthalene-1,5-dicarbonitrile (CID 11458009) is naphthalene-1,5-dicarbonitrile.
What is the SMILES notation for naphthalene-1,5-dicarbonitrile?
The canonical SMILES for naphthalene-1,5-dicarbonitrile is N#Cc1cccc2c(C#N)cccc12.
What is the InChIKey of naphthalene-1,5-dicarbonitrile?
The InChIKey is WNDSQRGJJHSKCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N2/c13-7-9-3-1-5-11-10(8-14)4-2-6-12(9)11/h1-6H.
What are the key properties of naphthalene-1,5-dicarbonitrile?
naphthalene-1,5-dicarbonitrile has a molecular weight of 178.19 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1,5-dicarbonitrile is sourced from PubChem (CID 11458009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).