C10H8N2O2S — CID 114581051
4-(2-hydroxyphenyl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 114581051) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-(2-hydroxyphenyl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114581051 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 4-(2-hydroxyphenyl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(Sc2ccccc2O)nc[nH]1 |
| InChI | InChI=1S/C10H8N2O2S/c13-7-3-1-2-4-8(7)15-10-5-9(14)11-6-12-10/h1-6,13H,(H,11,12,14) |
| InChIKey | MFQUNGJCXHZWBY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |