C8H11ClN4O2 — CID 114582756
3-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-methylpropanamide (PubChem CID 114582756) has the molecular formula C8H11ClN4O2 and a molecular weight of 230.66 g/mol. Its IUPAC name is 3-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-methylpropanamide.
| Compound Name | 3-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 114582756 |
| Molecular Formula | C8H11ClN4O2 |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 3-(5-amino-4-chloro-6-oxopyrimidin-1-yl)-N-methylpropanamide |
| SMILES | CNC(=O)CCn1cnc(Cl)c(N)c1=O |
| InChI | InChI=1S/C8H11ClN4O2/c1-11-5(14)2-3-13-4-12-7(9)6(10)8(13)15/h4H,2-3,10H2,1H3,(H,11,14) |
| InChIKey | JCMKVVSUXJIUSN-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |