C8H14ClN3O — CID 143220714
4-chloro-5-(ethylamino)-1H-pyrimidin-6-one;ethane (PubChem CID 143220714) has the molecular formula C8H14ClN3O and a molecular weight of 203.67 g/mol. Its IUPAC name is 4-chloro-5-(ethylamino)-1H-pyrimidin-6-one;ethane.
| Compound Name | 4-chloro-5-(ethylamino)-1H-pyrimidin-6-one;ethane |
|---|---|
| PubChem CID | 143220714 |
| Molecular Formula | C8H14ClN3O |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 4-chloro-5-(ethylamino)-1H-pyrimidin-6-one;ethane |
| SMILES | CC.CCNc1c(Cl)nc[nH]c1=O |
| InChI | InChI=1S/C6H8ClN3O.C2H6/c1-2-8-4-5(7)9-3-10-6(4)11;1-2/h3,8H,2H2,1H3,(H,9,10,11);1-2H3 |
| InChIKey | GJTMKESNDVENFV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |