C8H14N4O — CID 135814991
4,5-bis(ethylamino)-1H-pyrimidin-6-one (PubChem CID 135814991) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 4,5-bis(ethylamino)-1H-pyrimidin-6-one.
| Compound Name | 4,5-bis(ethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135814991 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 4,5-bis(ethylamino)-1H-pyrimidin-6-one |
| SMILES | CCNc1nc[nH]c(=O)c1NCC |
| InChI | InChI=1S/C8H14N4O/c1-3-9-6-7(10-4-2)11-5-12-8(6)13/h5,9H,3-4H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | FRIZIMKWIOAGEX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |