C7H9N5O — CID 137197399
2-[[4-(methylamino)-6-oxo-1H-pyrimidin-5-yl]amino]acetonitrile (PubChem CID 137197399) has the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-[[4-(methylamino)-6-oxo-1H-pyrimidin-5-yl]amino]acetonitrile.
| Compound Name | 2-[[4-(methylamino)-6-oxo-1H-pyrimidin-5-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 137197399 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-[[4-(methylamino)-6-oxo-1H-pyrimidin-5-yl]amino]acetonitrile |
| SMILES | CNc1nc[nH]c(=O)c1NCC#N |
| InChI | InChI=1S/C7H9N5O/c1-9-6-5(10-3-2-8)7(13)12-4-11-6/h4,10H,3H2,1H3,(H2,9,11,12,13) |
| InChIKey | GYQBAXNMFZOBNG-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|