C7H10N4O — CID 135703372
6-methyl-5,6,7,8-tetrahydro-3H-pteridin-4-one (PubChem CID 135703372) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 6-methyl-5,6,7,8-tetrahydro-3H-pteridin-4-one.
| Compound Name | 6-methyl-5,6,7,8-tetrahydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135703372 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 6-methyl-5,6,7,8-tetrahydro-3H-pteridin-4-one |
| SMILES | CC1CNc2nc[nH]c(=O)c2N1 |
| InChI | InChI=1S/C7H10N4O/c1-4-2-8-6-5(11-4)7(12)10-3-9-6/h3-4,11H,2H2,1H3,(H2,8,9,10,12) |
| InChIKey | MCVKVAZOVJGMHM-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |