C11H16Cl2N2O4 — CID 114582885
5,6-dichloro-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrimidin-4-one (PubChem CID 114582885) has the molecular formula C11H16Cl2N2O4 and a molecular weight of 311.17 g/mol. Its IUPAC name is 5,6-dichloro-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrimidin-4-one.
| Compound Name | 5,6-dichloro-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 114582885 |
| Molecular Formula | C11H16Cl2N2O4 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 5,6-dichloro-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrimidin-4-one |
| SMILES | COCCOCCOCCn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C11H16Cl2N2O4/c1-17-4-5-19-7-6-18-3-2-15-8-14-10(13)9(12)11(15)16/h8H,2-7H2,1H3 |
| InChIKey | NSWFFMDLNSGKBF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|