C8H7Cl2N3O — CID 114582960
4-(4,5-dichloro-6-oxopyrimidin-1-yl)butanenitrile (PubChem CID 114582960) has the molecular formula C8H7Cl2N3O and a molecular weight of 232.07 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyrimidin-1-yl)butanenitrile.
| Compound Name | 4-(4,5-dichloro-6-oxopyrimidin-1-yl)butanenitrile |
|---|---|
| PubChem CID | 114582960 |
| Molecular Formula | C8H7Cl2N3O |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyrimidin-1-yl)butanenitrile |
| SMILES | N#CCCCn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C8H7Cl2N3O/c9-6-7(10)12-5-13(8(6)14)4-2-1-3-11/h5H,1-2,4H2 |
| InChIKey | QXWRSJJGLQFFSX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|