C6H3Cl2N3O — CID 114582897
2-(4,5-dichloro-6-oxopyrimidin-1-yl)acetonitrile (PubChem CID 114582897) has the molecular formula C6H3Cl2N3O and a molecular weight of 204.02 g/mol. Its IUPAC name is 2-(4,5-dichloro-6-oxopyrimidin-1-yl)acetonitrile.
| Compound Name | 2-(4,5-dichloro-6-oxopyrimidin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 114582897 |
| Molecular Formula | C6H3Cl2N3O |
| Molecular Weight | 204.02 g/mol |
| Exact Mass | 202.97 |
| IUPAC Name | 2-(4,5-dichloro-6-oxopyrimidin-1-yl)acetonitrile |
| SMILES | N#CCn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C6H3Cl2N3O/c7-4-5(8)10-3-11(2-1-9)6(4)12/h3H,2H2 |
| InChIKey | NOXGCJXNTYYSKU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.02 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |