C10H13Cl2N3O2 — CID 114582981
4-(4,5-dichloro-6-oxopyrimidin-1-yl)-N,N-dimethylbutanamide (PubChem CID 114582981) has the molecular formula C10H13Cl2N3O2 and a molecular weight of 278.14 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyrimidin-1-yl)-N,N-dimethylbutanamide.
| Compound Name | 4-(4,5-dichloro-6-oxopyrimidin-1-yl)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 114582981 |
| Molecular Formula | C10H13Cl2N3O2 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyrimidin-1-yl)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCn1cnc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C10H13Cl2N3O2/c1-14(2)7(16)4-3-5-15-6-13-9(12)8(11)10(15)17/h6H,3-5H2,1-2H3 |
| InChIKey | PYGDOMXIZNQHPY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |